3-(Benzyloxy)-2,6-difluorobenzeneboronic acid
Catalog No: FT-0656714
CAS No: 870718-07-3
- Chemical Name: 3-(Benzyloxy)-2,6-difluorobenzeneboronic acid
- Molecular Formula: C13H11BF2O3
- Molecular Weight: 264.03
- InChI Key: MUKMMBLTLNKOAC-UHFFFAOYSA-N
- InChI: InChI=1S/C13H11BF2O3/c15-10-6-7-11(13(16)12(10)14(17)18)19-8-9-4-2-1-3-5-9/h1-7,17-18H,8H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | [3-(Benzyloxy)-2,6-difluorophenyl]boronic acid |
|---|---|
| Flash_Point: | 219.6±31.5 °C |
| Melting_Point: | 112-118ºC(lit.) |
| FW: | 264.032 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 870718-07-3 |
| Bolling_Point: | 439.6±55.0 °C at 760 mmHg |
| MF: | C13H11BF2O3 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 3.33 |
| Flash_Point: | 219.6±31.5 °C |
| Melting_Point: | 112-118ºC(lit.) |
| FW: | 264.032 |
| PSA: | 49.69000 |
| Exact_Mass: | 264.076935 |
| MF: | C13H11BF2O3 |
| Bolling_Point: | 439.6±55.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Refractive_Index: | 1.563 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2931900090 |
| Safety_Statements: | 22-24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)